About (2,4-dinitrophenoxy)-iodo-methyl-λ3-iodane
(2,4-dinitrophenoxy)-iodo-methyl-λ3-iodane (PubChem CID 163826627) has the molecular formula C7H6I2N2O5
and a molecular weight of 451.94 g/mol. Its IUPAC name is (2,4-dinitrophenoxy)-iodo-methyl-λ3-iodane.
Molecular Properties
| Compound Name | (2,4-dinitrophenoxy)-iodo-methyl-λ3-iodane |
| PubChem CID | 163826627 |
| Molecular Formula | C7H6I2N2O5 |
| Molecular Weight | 451.94 g/mol |
| Exact Mass | 451.84 |
| IUPAC Name | (2,4-dinitrophenoxy)-iodo-methyl-λ3-iodane |
| SMILES | CI(I)Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H6I2N2O5/c1-9(8)16-7-3-2-5(10(12)13)4-6(7)11(14)15/h2-4H,1H3 |
| InChIKey | OAARXNDDRVBMJM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.94 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dinitrophenoxy)-iodo-methyl-λ3-iodane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dinitrophenoxy)-iodo-methyl-λ3-iodane?
The IUPAC name of (2,4-dinitrophenoxy)-iodo-methyl-λ3-iodane (CID 163826627) is (2,4-dinitrophenoxy)-iodo-methyl-λ3-iodane.
What is the SMILES notation for (2,4-dinitrophenoxy)-iodo-methyl-λ3-iodane?
The canonical SMILES for (2,4-dinitrophenoxy)-iodo-methyl-λ3-iodane is CI(I)Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of (2,4-dinitrophenoxy)-iodo-methyl-λ3-iodane?
The InChIKey is OAARXNDDRVBMJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6I2N2O5/c1-9(8)16-7-3-2-5(10(12)13)4-6(7)11(14)15/h2-4H,1H3.
What are the key properties of (2,4-dinitrophenoxy)-iodo-methyl-λ3-iodane?
(2,4-dinitrophenoxy)-iodo-methyl-λ3-iodane has a molecular weight of 451.94 g/mol, XLogP of 3.28, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dinitrophenoxy)-iodo-methyl-λ3-iodane is sourced from PubChem (CID 163826627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).