C10H6N2O7S2 — CID 13159815
(2,4-dinitrophenyl) thiophene-2-sulfonate (PubChem CID 13159815) has the molecular formula C10H6N2O7S2 and a molecular weight of 330.30 g/mol. Its IUPAC name is (2,4-dinitrophenyl) thiophene-2-sulfonate.
| Compound Name | (2,4-dinitrophenyl) thiophene-2-sulfonate |
|---|---|
| PubChem CID | 13159815 |
| Molecular Formula | C10H6N2O7S2 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | (2,4-dinitrophenyl) thiophene-2-sulfonate |
| SMILES | O=[N+]([O-])c1ccc(OS(=O)(=O)c2cccs2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H6N2O7S2/c13-11(14)7-3-4-9(8(6-7)12(15)16)19-21(17,18)10-2-1-5-20-10/h1-6H |
| InChIKey | YSKSBGKCLSIPRI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|