C18H14FNO7S2 — CID 35316948
(4-nitro-2-thiophen-2-ylphenyl) 2-fluoro-4,5-dimethoxybenzenesulfonate (PubChem CID 35316948) has the molecular formula C18H14FNO7S2 and a molecular weight of 439.44 g/mol. Its IUPAC name is (4-nitro-2-thiophen-2-ylphenyl) 2-fluoro-4,5-dimethoxybenzenesulfonate.
| Compound Name | (4-nitro-2-thiophen-2-ylphenyl) 2-fluoro-4,5-dimethoxybenzenesulfonate |
|---|---|
| PubChem CID | 35316948 |
| Molecular Formula | C18H14FNO7S2 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.02 |
| IUPAC Name | (4-nitro-2-thiophen-2-ylphenyl) 2-fluoro-4,5-dimethoxybenzenesulfonate |
| SMILES | COc1cc(F)c(S(=O)(=O)Oc2ccc([N+](=O)[O-])cc2-c2cccs2)cc1OC |
| InChI | InChI=1S/C18H14FNO7S2/c1-25-15-9-13(19)18(10-16(15)26-2)29(23,24)27-14-6-5-11(20(21)22)8-12(14)17-4-3-7-28-17/h3-10H,1-2H3 |
| InChIKey | MFELLZDUQQRLNI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|