About (4-nitro-2-thiophen-2-ylphenyl) 3-acetylbenzenesulfonate
(4-nitro-2-thiophen-2-ylphenyl) 3-acetylbenzenesulfonate (PubChem CID 24511305) has the molecular formula C18H13NO6S2
and a molecular weight of 403.44 g/mol. Its IUPAC name is (4-nitro-2-thiophen-2-ylphenyl) 3-acetylbenzenesulfonate.
Molecular Properties
| Compound Name | (4-nitro-2-thiophen-2-ylphenyl) 3-acetylbenzenesulfonate |
| PubChem CID | 24511305 |
| Molecular Formula | C18H13NO6S2 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | (4-nitro-2-thiophen-2-ylphenyl) 3-acetylbenzenesulfonate |
| SMILES | CC(=O)c1cccc(S(=O)(=O)Oc2ccc([N+](=O)[O-])cc2-c2cccs2)c1 |
| InChI | InChI=1S/C18H13NO6S2/c1-12(20)13-4-2-5-15(10-13)27(23,24)25-17-8-7-14(19(21)22)11-16(17)18-6-3-9-26-18/h2-11H,1H3 |
| InChIKey | LQKKXAHQZSJDGV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-nitro-2-thiophen-2-ylphenyl) 3-acetylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitro-2-thiophen-2-ylphenyl) 3-acetylbenzenesulfonate?
The IUPAC name of (4-nitro-2-thiophen-2-ylphenyl) 3-acetylbenzenesulfonate (CID 24511305) is (4-nitro-2-thiophen-2-ylphenyl) 3-acetylbenzenesulfonate.
What is the SMILES notation for (4-nitro-2-thiophen-2-ylphenyl) 3-acetylbenzenesulfonate?
The canonical SMILES for (4-nitro-2-thiophen-2-ylphenyl) 3-acetylbenzenesulfonate is CC(=O)c1cccc(S(=O)(=O)Oc2ccc([N+](=O)[O-])cc2-c2cccs2)c1.
What is the InChIKey of (4-nitro-2-thiophen-2-ylphenyl) 3-acetylbenzenesulfonate?
The InChIKey is LQKKXAHQZSJDGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13NO6S2/c1-12(20)13-4-2-5-15(10-13)27(23,24)25-17-8-7-14(19(21)22)11-16(17)18-6-3-9-26-18/h2-11H,1H3.
What are the key properties of (4-nitro-2-thiophen-2-ylphenyl) 3-acetylbenzenesulfonate?
(4-nitro-2-thiophen-2-ylphenyl) 3-acetylbenzenesulfonate has a molecular weight of 403.44 g/mol, XLogP of 4.29, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitro-2-thiophen-2-ylphenyl) 3-acetylbenzenesulfonate is sourced from PubChem (CID 24511305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).