About (4-nitro-2-thiophen-2-ylphenyl) 3-cyanobenzenesulfonate
(4-nitro-2-thiophen-2-ylphenyl) 3-cyanobenzenesulfonate (PubChem CID 24511310) has the molecular formula C17H10N2O5S2
and a molecular weight of 386.41 g/mol. Its IUPAC name is (4-nitro-2-thiophen-2-ylphenyl) 3-cyanobenzenesulfonate.
Molecular Properties
| Compound Name | (4-nitro-2-thiophen-2-ylphenyl) 3-cyanobenzenesulfonate |
| PubChem CID | 24511310 |
| Molecular Formula | C17H10N2O5S2 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | (4-nitro-2-thiophen-2-ylphenyl) 3-cyanobenzenesulfonate |
| SMILES | N#Cc1cccc(S(=O)(=O)Oc2ccc([N+](=O)[O-])cc2-c2cccs2)c1 |
| InChI | InChI=1S/C17H10N2O5S2/c18-11-12-3-1-4-14(9-12)26(22,23)24-16-7-6-13(19(20)21)10-15(16)17-5-2-8-25-17/h1-10H |
| InChIKey | GRVRIGXVGQXWBG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 110.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-nitro-2-thiophen-2-ylphenyl) 3-cyanobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitro-2-thiophen-2-ylphenyl) 3-cyanobenzenesulfonate?
The IUPAC name of (4-nitro-2-thiophen-2-ylphenyl) 3-cyanobenzenesulfonate (CID 24511310) is (4-nitro-2-thiophen-2-ylphenyl) 3-cyanobenzenesulfonate.
What is the SMILES notation for (4-nitro-2-thiophen-2-ylphenyl) 3-cyanobenzenesulfonate?
The canonical SMILES for (4-nitro-2-thiophen-2-ylphenyl) 3-cyanobenzenesulfonate is N#Cc1cccc(S(=O)(=O)Oc2ccc([N+](=O)[O-])cc2-c2cccs2)c1.
What is the InChIKey of (4-nitro-2-thiophen-2-ylphenyl) 3-cyanobenzenesulfonate?
The InChIKey is GRVRIGXVGQXWBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10N2O5S2/c18-11-12-3-1-4-14(9-12)26(22,23)24-16-7-6-13(19(20)21)10-15(16)17-5-2-8-25-17/h1-10H.
What are the key properties of (4-nitro-2-thiophen-2-ylphenyl) 3-cyanobenzenesulfonate?
(4-nitro-2-thiophen-2-ylphenyl) 3-cyanobenzenesulfonate has a molecular weight of 386.41 g/mol, XLogP of 3.96, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitro-2-thiophen-2-ylphenyl) 3-cyanobenzenesulfonate is sourced from PubChem (CID 24511310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).