About (2-bromo-4-methylphenyl) 3-cyanobenzenesulfonate
(2-bromo-4-methylphenyl) 3-cyanobenzenesulfonate (PubChem CID 26946860) has the molecular formula C14H10BrNO3S
and a molecular weight of 352.21 g/mol. Its IUPAC name is (2-bromo-4-methylphenyl) 3-cyanobenzenesulfonate.
Molecular Properties
| Compound Name | (2-bromo-4-methylphenyl) 3-cyanobenzenesulfonate |
| PubChem CID | 26946860 |
| Molecular Formula | C14H10BrNO3S |
| Molecular Weight | 352.21 g/mol |
| Exact Mass | 350.96 |
| IUPAC Name | (2-bromo-4-methylphenyl) 3-cyanobenzenesulfonate |
| SMILES | Cc1ccc(OS(=O)(=O)c2cccc(C#N)c2)c(Br)c1 |
| InChI | InChI=1S/C14H10BrNO3S/c1-10-5-6-14(13(15)7-10)19-20(17,18)12-4-2-3-11(8-12)9-16/h2-8H,1H3 |
| InChIKey | HNDQABMXTSUQNV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.21 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-4-methylphenyl) 3-cyanobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-4-methylphenyl) 3-cyanobenzenesulfonate?
The IUPAC name of (2-bromo-4-methylphenyl) 3-cyanobenzenesulfonate (CID 26946860) is (2-bromo-4-methylphenyl) 3-cyanobenzenesulfonate.
What is the SMILES notation for (2-bromo-4-methylphenyl) 3-cyanobenzenesulfonate?
The canonical SMILES for (2-bromo-4-methylphenyl) 3-cyanobenzenesulfonate is Cc1ccc(OS(=O)(=O)c2cccc(C#N)c2)c(Br)c1.
What is the InChIKey of (2-bromo-4-methylphenyl) 3-cyanobenzenesulfonate?
The InChIKey is HNDQABMXTSUQNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrNO3S/c1-10-5-6-14(13(15)7-10)19-20(17,18)12-4-2-3-11(8-12)9-16/h2-8H,1H3.
What are the key properties of (2-bromo-4-methylphenyl) 3-cyanobenzenesulfonate?
(2-bromo-4-methylphenyl) 3-cyanobenzenesulfonate has a molecular weight of 352.21 g/mol, XLogP of 3.40, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-4-methylphenyl) 3-cyanobenzenesulfonate is sourced from PubChem (CID 26946860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).