C13H10N4O3S — CID 66488042
3-(2-methoxy-5-nitrophenyl)-5-thiophen-2-yl-1H-1,2,4-triazole (PubChem CID 66488042) has the molecular formula C13H10N4O3S and a molecular weight of 302.31 g/mol. Its IUPAC name is 3-(2-methoxy-5-nitrophenyl)-5-thiophen-2-yl-1H-1,2,4-triazole.
| Compound Name | 3-(2-methoxy-5-nitrophenyl)-5-thiophen-2-yl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 66488042 |
| Molecular Formula | C13H10N4O3S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 3-(2-methoxy-5-nitrophenyl)-5-thiophen-2-yl-1H-1,2,4-triazole |
| SMILES | COc1ccc([N+](=O)[O-])cc1-c1n[nH]c(-c2cccs2)n1 |
| InChI | InChI=1S/C13H10N4O3S/c1-20-10-5-4-8(17(18)19)7-9(10)12-14-13(16-15-12)11-3-2-6-21-11/h2-7H,1H3,(H,14,15,16) |
| InChIKey | YAEGWEILJCLIEX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|