C10H11BrN2O5 — CID 139648984
1-(4-bromobutoxy)-2,4-dinitrobenzene (PubChem CID 139648984) has the molecular formula C10H11BrN2O5 and a molecular weight of 319.11 g/mol. Its IUPAC name is 1-(4-bromobutoxy)-2,4-dinitrobenzene.
| Compound Name | 1-(4-bromobutoxy)-2,4-dinitrobenzene |
|---|---|
| PubChem CID | 139648984 |
| Molecular Formula | C10H11BrN2O5 |
| Molecular Weight | 319.11 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 1-(4-bromobutoxy)-2,4-dinitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(OCCCCBr)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H11BrN2O5/c11-5-1-2-6-18-10-4-3-8(12(14)15)7-9(10)13(16)17/h3-4,7H,1-2,5-6H2 |
| InChIKey | XVRPKFWVRDIDRP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.11 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|