C18H16N4O10 — CID 90487099
1-[(Z)-6-(2,4-dinitrophenoxy)hex-4-enoxy]-2,4-dinitrobenzene (PubChem CID 90487099) has the molecular formula C18H16N4O10 and a molecular weight of 448.34 g/mol. Its IUPAC name is 1-[(Z)-6-(2,4-dinitrophenoxy)hex-4-enoxy]-2,4-dinitrobenzene.
| Compound Name | 1-[(Z)-6-(2,4-dinitrophenoxy)hex-4-enoxy]-2,4-dinitrobenzene |
|---|---|
| PubChem CID | 90487099 |
| Molecular Formula | C18H16N4O10 |
| Molecular Weight | 448.34 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 1-[(Z)-6-(2,4-dinitrophenoxy)hex-4-enoxy]-2,4-dinitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(OC/C=C\CCCOc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16N4O10/c23-19(24)13-5-7-17(15(11-13)21(27)28)31-9-3-1-2-4-10-32-18-8-6-14(20(25)26)12-16(18)22(29)30/h1,3,5-8,11-12H,2,4,9-10H2/b3-1- |
| InChIKey | FMBRDFHZJCJOBT-IWQZZHSRSA-N |
| XLogP | 4.11 |
| TPSA | 191.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|