C15H16N2O5 — CID 98556373
(1S,2S,3R,5R,6S)-3-[(2,4-dinitrophenyl)methoxy]tricyclo[4.2.0.02,5]octane (PubChem CID 98556373) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is (1S,2S,3R,5R,6S)-3-[(2,4-dinitrophenyl)methoxy]tricyclo[4.2.0.02,5]octane.
| Compound Name | (1S,2S,3R,5R,6S)-3-[(2,4-dinitrophenyl)methoxy]tricyclo[4.2.0.02,5]octane |
|---|---|
| PubChem CID | 98556373 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (1S,2S,3R,5R,6S)-3-[(2,4-dinitrophenyl)methoxy]tricyclo[4.2.0.02,5]octane |
| SMILES | O=[N+]([O-])c1ccc(CO[C@@H]2C[C@@H]3[C@H]4CC[C@@H]4[C@@H]32)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H16N2O5/c18-16(19)9-2-1-8(13(5-9)17(20)21)7-22-14-6-12-10-3-4-11(10)15(12)14/h1-2,5,10-12,14-15H,3-4,6-7H2/t10-,11-,12+,14+,15-/m0/s1 |
| InChIKey | LCQCZRRBUXXKQU-OBORUHMCSA-N |
| XLogP | 3.06 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|