C18H18N2O5 — CID 99954998
(1S,2R,3R,4S,6R,7S,8R,10S,11R)-4-[(2,4-dinitrophenyl)methoxy]pentacyclo[5.4.0.02,6.03,11.08,10]undecane (PubChem CID 99954998) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is (1S,2R,3R,4S,6R,7S,8R,10S,11R)-4-[(2,4-dinitrophenyl)methoxy]pentacyclo[5.4.0.02,6.03,11.08,10]undecane.
| Compound Name | (1S,2R,3R,4S,6R,7S,8R,10S,11R)-4-[(2,4-dinitrophenyl)methoxy]pentacyclo[5.4.0.02,6.03,11.08,10]undecane |
|---|---|
| PubChem CID | 99954998 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (1S,2R,3R,4S,6R,7S,8R,10S,11R)-4-[(2,4-dinitrophenyl)methoxy]pentacyclo[5.4.0.02,6.03,11.08,10]undecane |
| SMILES | O=[N+]([O-])c1ccc(CO[C@H]2C[C@@H]3[C@@H]4[C@@H]5C[C@@H]5[C@@H]5[C@@H]4[C@@H]3[C@@H]52)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H18N2O5/c21-19(22)8-2-1-7(12(3-8)20(23)24)6-25-13-5-11-14-9-4-10(9)15-17(13)16(11)18(14)15/h1-3,9-11,13-18H,4-6H2/t9-,10+,11-,13+,14+,15+,16+,17-,18-/m1/s1 |
| InChIKey | NEBJMRBTFOQIIY-FUEPQFGCSA-N |
| XLogP | 3.17 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|