C24H20N2O5 — CID 98555554
(1S,2S,3S,6S,7S,8S)-17-[(2,4-dinitrophenyl)methoxy]pentacyclo[6.6.2.13,6.02,7.09,14]heptadeca-4,9,11,13,15-pentaene (PubChem CID 98555554) has the molecular formula C24H20N2O5 and a molecular weight of 416.43 g/mol. Its IUPAC name is (1S,2S,3S,6S,7S,8S)-17-[(2,4-dinitrophenyl)methoxy]pentacyclo[6.6.2.13,6.02,7.09,14]heptadeca-4,9,11,13,15-pentaene.
| Compound Name | (1S,2S,3S,6S,7S,8S)-17-[(2,4-dinitrophenyl)methoxy]pentacyclo[6.6.2.13,6.02,7.09,14]heptadeca-4,9,11,13,15-pentaene |
|---|---|
| PubChem CID | 98555554 |
| Molecular Formula | C24H20N2O5 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | (1S,2S,3S,6S,7S,8S)-17-[(2,4-dinitrophenyl)methoxy]pentacyclo[6.6.2.13,6.02,7.09,14]heptadeca-4,9,11,13,15-pentaene |
| SMILES | O=[N+]([O-])c1ccc(COC2[C@H]3C=C[C@H]2[C@H]2[C@H]3[C@@H]3C=C[C@@H]2c2ccccc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H20N2O5/c27-25(28)14-6-5-13(21(11-14)26(29)30)12-31-24-19-9-10-20(24)23-18-8-7-17(22(19)23)15-3-1-2-4-16(15)18/h1-11,17-20,22-24H,12H2/t17-,18-,19+,20+,22+,23+/m1/s1 |
| InChIKey | WOIFGKFONXIBLL-SZAWYWIZSA-N |
| XLogP | 4.89 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|