C27H24N2O5 — CID 90487101
6-(2,4-dinitrophenoxy)-3,3-dimethyl-2,4-diphenyltricyclo[3.2.0.02,4]heptane (PubChem CID 90487101) has the molecular formula C27H24N2O5 and a molecular weight of 456.50 g/mol. Its IUPAC name is 6-(2,4-dinitrophenoxy)-3,3-dimethyl-2,4-diphenyltricyclo[3.2.0.02,4]heptane.
| Compound Name | 6-(2,4-dinitrophenoxy)-3,3-dimethyl-2,4-diphenyltricyclo[3.2.0.02,4]heptane |
|---|---|
| PubChem CID | 90487101 |
| Molecular Formula | C27H24N2O5 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 6-(2,4-dinitrophenoxy)-3,3-dimethyl-2,4-diphenyltricyclo[3.2.0.02,4]heptane |
| SMILES | CC1(C)C2(c3ccccc3)C3CC(Oc4ccc([N+](=O)[O-])cc4[N+](=O)[O-])C3C12c1ccccc1 |
| InChI | InChI=1S/C27H24N2O5/c1-25(2)26(17-9-5-3-6-10-17)20-16-23(24(20)27(25,26)18-11-7-4-8-12-18)34-22-14-13-19(28(30)31)15-21(22)29(32)33/h3-15,20,23-24H,16H2,1-2H3 |
| InChIKey | PKVJOCRCDBBKCX-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|