C15H17NO9 — CID 45040066
[3-acetyloxy-5-hydroxy-2-(2-nitrophenoxy)oxan-4-yl] acetate (PubChem CID 45040066) has the molecular formula C15H17NO9 and a molecular weight of 355.30 g/mol. Its IUPAC name is [3-acetyloxy-5-hydroxy-2-(2-nitrophenoxy)oxan-4-yl] acetate.
| Compound Name | [3-acetyloxy-5-hydroxy-2-(2-nitrophenoxy)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 45040066 |
| Molecular Formula | C15H17NO9 |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | [3-acetyloxy-5-hydroxy-2-(2-nitrophenoxy)oxan-4-yl] acetate |
| SMILES | CC(=O)OC1C(O)COC(Oc2ccccc2[N+](=O)[O-])C1OC(C)=O |
| InChI | InChI=1S/C15H17NO9/c1-8(17)23-13-11(19)7-22-15(14(13)24-9(2)18)25-12-6-4-3-5-10(12)16(20)21/h3-6,11,13-15,19H,7H2,1-2H3 |
| InChIKey | OPXWOTRGXPBRCG-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|