C21H31NO9Si — CID 124895139
[(2R,3R,4R,5R)-3-acetyloxy-2-(2-nitrophenoxy)-5-triethylsilyloxyoxan-4-yl] acetate (PubChem CID 124895139) has the molecular formula C21H31NO9Si and a molecular weight of 469.56 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3-acetyloxy-2-(2-nitrophenoxy)-5-triethylsilyloxyoxan-4-yl] acetate.
| Compound Name | [(2R,3R,4R,5R)-3-acetyloxy-2-(2-nitrophenoxy)-5-triethylsilyloxyoxan-4-yl] acetate |
|---|---|
| PubChem CID | 124895139 |
| Molecular Formula | C21H31NO9Si |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | [(2R,3R,4R,5R)-3-acetyloxy-2-(2-nitrophenoxy)-5-triethylsilyloxyoxan-4-yl] acetate |
| SMILES | CC[Si](CC)(CC)O[C@@H]1CO[C@H](Oc2ccccc2[N+](=O)[O-])[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H31NO9Si/c1-6-32(7-2,8-3)31-18-13-27-21(20(29-15(5)24)19(18)28-14(4)23)30-17-12-10-9-11-16(17)22(25)26/h9-12,18-21H,6-8,13H2,1-5H3/t18-,19+,20-,21-/m1/s1 |
| InChIKey | BFEHWXCZKFZQCB-PLACYPQZSA-N |
| XLogP | 3.58 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|