C41H62O13Si2 — CID 10509650
[(2S,3R,4R,5R)-2-[(3S,4S,5R,6S)-4,5-diacetyloxy-6-phenylmethoxyoxan-3-yl]oxy-4,5-bis(triethylsilyloxy)oxan-3-yl] 4-methoxybenzoate (PubChem CID 10509650) has the molecular formula C41H62O13Si2 and a molecular weight of 819.11 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-2-[(3S,4S,5R,6S)-4,5-diacetyloxy-6-phenylmethoxyoxan-3-yl]oxy-4,5-bis(triethylsilyloxy)oxan-3-yl] 4-methoxybenzoate.
| Compound Name | [(2S,3R,4R,5R)-2-[(3S,4S,5R,6S)-4,5-diacetyloxy-6-phenylmethoxyoxan-3-yl]oxy-4,5-bis(triethylsilyloxy)oxan-3-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 10509650 |
| Molecular Formula | C41H62O13Si2 |
| Molecular Weight | 819.11 g/mol |
| Exact Mass | 818.37 |
| IUPAC Name | [(2S,3R,4R,5R)-2-[(3S,4S,5R,6S)-4,5-diacetyloxy-6-phenylmethoxyoxan-3-yl]oxy-4,5-bis(triethylsilyloxy)oxan-3-yl] 4-methoxybenzoate |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H](OC(=O)c2ccc(OC)cc2)[C@H](O[C@H]2CO[C@H](OCc3ccccc3)[C@H](OC(C)=O)[C@H]2OC(C)=O)OC[C@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C41H62O13Si2/c1-10-55(11-2,12-3)53-34-27-48-41(38(36(34)54-56(13-4,14-5)15-6)52-39(44)31-21-23-32(45-9)24-22-31)51-33-26-47-40(46-25-30-19-17-16-18-20-30)37(50-29(8)43)35(33)49-28(7)42/h16-24,33-38,40-41H,10-15,25-27H2,1-9H3/t33-,34+,35-,36-,37+,38+,40-,41-/m0/s1 |
| InChIKey | MZGYUWQSSANTPA-FLJYNXPLSA-N |
| XLogP | 7.18 |
| TPSA | 143.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.11 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|