C29H28Cl3NO7 — CID 101355074
[(3R,4S,5R)-4,5-bis(phenylmethoxy)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] 4-methoxybenzoate (PubChem CID 101355074) has the molecular formula C29H28Cl3NO7 and a molecular weight of 608.90 g/mol. Its IUPAC name is [(3R,4S,5R)-4,5-bis(phenylmethoxy)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] 4-methoxybenzoate.
| Compound Name | [(3R,4S,5R)-4,5-bis(phenylmethoxy)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 101355074 |
| Molecular Formula | C29H28Cl3NO7 |
| Molecular Weight | 608.90 g/mol |
| Exact Mass | 607.09 |
| IUPAC Name | [(3R,4S,5R)-4,5-bis(phenylmethoxy)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] 4-methoxybenzoate |
| SMILES | [H]/N=C(/OC1OCC(OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OC(=O)c1ccc(OC)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C29H28Cl3NO7/c1-35-22-14-12-21(13-15-22)26(34)39-25-24(37-17-20-10-6-3-7-11-20)23(36-16-19-8-4-2-5-9-19)18-38-27(25)40-28(33)29(30,31)32/h2-15,23-25,27,33H,16-18H2,1H3/b33-28+/t23?,24-,25+,27?/m0/s1 |
| InChIKey | ZHPLSMYNEBLDOE-MTIQIRBZSA-N |
| XLogP | 6.11 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.90 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|