C18H20O10 — CID 53496773
[(2S,3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl] 2-hydroxybenzoate (PubChem CID 53496773) has the molecular formula C18H20O10 and a molecular weight of 396.35 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl] 2-hydroxybenzoate.
| Compound Name | [(2S,3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 53496773 |
| Molecular Formula | C18H20O10 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | [(2S,3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl] 2-hydroxybenzoate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](OC(=O)c2ccccc2O)OC[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H20O10/c1-9(19)25-14-8-24-18(16(27-11(3)21)15(14)26-10(2)20)28-17(23)12-6-4-5-7-13(12)22/h4-7,14-16,18,22H,8H2,1-3H3/t14-,15+,16-,18+/m1/s1 |
| InChIKey | UKZPUXRGNZFDJL-HPFXQQBRSA-N |
| XLogP | 0.70 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|