C16H17ClN2O10S — CID 102229243
[(1R,4R,5R)-2-acetyloxy-4-chloro-5-(2,4-dinitrophenyl)sulfonylcyclohexyl] acetate (PubChem CID 102229243) has the molecular formula C16H17ClN2O10S and a molecular weight of 464.84 g/mol. Its IUPAC name is [(1R,4R,5R)-2-acetyloxy-4-chloro-5-(2,4-dinitrophenyl)sulfonylcyclohexyl] acetate.
| Compound Name | [(1R,4R,5R)-2-acetyloxy-4-chloro-5-(2,4-dinitrophenyl)sulfonylcyclohexyl] acetate |
|---|---|
| PubChem CID | 102229243 |
| Molecular Formula | C16H17ClN2O10S |
| Molecular Weight | 464.84 g/mol |
| Exact Mass | 464.03 |
| IUPAC Name | [(1R,4R,5R)-2-acetyloxy-4-chloro-5-(2,4-dinitrophenyl)sulfonylcyclohexyl] acetate |
| SMILES | CC(=O)OC1C[C@@H](Cl)[C@H](S(=O)(=O)c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H17ClN2O10S/c1-8(20)28-13-6-11(17)16(7-14(13)29-9(2)21)30(26,27)15-4-3-10(18(22)23)5-12(15)19(24)25/h3-5,11,13-14,16H,6-7H2,1-2H3/t11-,13?,14-,16-/m1/s1 |
| InChIKey | HKHZHNRNANBVTM-WFDQHJCASA-N |
| XLogP | 1.91 |
| TPSA | 173.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.84 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|