C20H24N4O14S — CID 102481578
[(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[(2,4-dinitrophenyl)sulfonylamino]oxan-2-yl]methyl acetate (PubChem CID 102481578) has the molecular formula C20H24N4O14S and a molecular weight of 576.49 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[(2,4-dinitrophenyl)sulfonylamino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[(2,4-dinitrophenyl)sulfonylamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102481578 |
| Molecular Formula | C20H24N4O14S |
| Molecular Weight | 576.49 g/mol |
| Exact Mass | 576.10 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[(2,4-dinitrophenyl)sulfonylamino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O[C@H]1NS(=O)(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H24N4O14S/c1-9(25)21-17-19(37-12(4)28)18(36-11(3)27)15(8-35-10(2)26)38-20(17)22-39(33,34)16-6-5-13(23(29)30)7-14(16)24(31)32/h5-7,15,17-20,22H,8H2,1-4H3,(H,21,25)/t15-,17-,18-,19-,20-/m1/s1 |
| InChIKey | YXBNBCFZEICOLN-YHUYVZNPSA-N |
| XLogP | -0.56 |
| TPSA | 249.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.49 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|