C23H29N3O14 — CID 100970584
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-(2,4-dinitroanilino)propoxy]oxan-2-yl]methyl acetate (PubChem CID 100970584) has the molecular formula C23H29N3O14 and a molecular weight of 571.49 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-(2,4-dinitroanilino)propoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-(2,4-dinitroanilino)propoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 100970584 |
| Molecular Formula | C23H29N3O14 |
| Molecular Weight | 571.49 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-(2,4-dinitroanilino)propoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OCCCNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H29N3O14/c1-12(27)36-11-19-20(37-13(2)28)21(38-14(3)29)22(39-15(4)30)23(40-19)35-9-5-8-24-17-7-6-16(25(31)32)10-18(17)26(33)34/h6-7,10,19-24H,5,8-9,11H2,1-4H3/t19-,20-,21+,22-,23-/m1/s1 |
| InChIKey | ZJNVUUOEQDONDP-XNBWIAOKSA-N |
| XLogP | 1.40 |
| TPSA | 221.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.49 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|