C18H20BrN3O11 — CID 88773531
[(2R,3S,4R,5S,6R)-3,4-diacetyloxy-6-bromo-5-(2,4-dinitroanilino)oxan-2-yl]methyl acetate (PubChem CID 88773531) has the molecular formula C18H20BrN3O11 and a molecular weight of 534.27 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6R)-3,4-diacetyloxy-6-bromo-5-(2,4-dinitroanilino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5S,6R)-3,4-diacetyloxy-6-bromo-5-(2,4-dinitroanilino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 88773531 |
| Molecular Formula | C18H20BrN3O11 |
| Molecular Weight | 534.27 g/mol |
| Exact Mass | 533.03 |
| IUPAC Name | [(2R,3S,4R,5S,6R)-3,4-diacetyloxy-6-bromo-5-(2,4-dinitroanilino)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](Br)[C@@H](Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H20BrN3O11/c1-8(23)30-7-14-16(31-9(2)24)17(32-10(3)25)15(18(19)33-14)20-12-5-4-11(21(26)27)6-13(12)22(28)29/h4-6,14-18,20H,7H2,1-3H3/t14-,15+,16-,17-,18+/m1/s1 |
| InChIKey | UEYBDGITNGDJHD-ILOCAZANSA-N |
| XLogP | 1.83 |
| TPSA | 186.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|