C20H23N3O15S — CID 89026191
[(3R,4S,6R)-3,4,5-triacetyloxy-6-[(2,4-dinitrophenyl)sulfonylamino]oxan-2-yl]methyl acetate (PubChem CID 89026191) has the molecular formula C20H23N3O15S and a molecular weight of 577.48 g/mol. Its IUPAC name is [(3R,4S,6R)-3,4,5-triacetyloxy-6-[(2,4-dinitrophenyl)sulfonylamino]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,4S,6R)-3,4,5-triacetyloxy-6-[(2,4-dinitrophenyl)sulfonylamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 89026191 |
| Molecular Formula | C20H23N3O15S |
| Molecular Weight | 577.48 g/mol |
| Exact Mass | 577.08 |
| IUPAC Name | [(3R,4S,6R)-3,4,5-triacetyloxy-6-[(2,4-dinitrophenyl)sulfonylamino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](NS(=O)(=O)c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C(OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H23N3O15S/c1-9(24)34-8-15-17(35-10(2)25)18(36-11(3)26)19(37-12(4)27)20(38-15)21-39(32,33)16-6-5-13(22(28)29)7-14(16)23(30)31/h5-7,15,17-21H,8H2,1-4H3/t15?,17-,18+,19?,20-/m1/s1 |
| InChIKey | YJZAVJPFRRQHDE-KSPCGEAZSA-N |
| XLogP | -0.14 |
| TPSA | 246.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.48 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|