C21H23IN2O12 — CID 71507034
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2-iodo-5-nitrobenzoyl)amino]oxan-2-yl]methyl acetate (PubChem CID 71507034) has the molecular formula C21H23IN2O12 and a molecular weight of 622.32 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2-iodo-5-nitrobenzoyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2-iodo-5-nitrobenzoyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71507034 |
| Molecular Formula | C21H23IN2O12 |
| Molecular Weight | 622.32 g/mol |
| Exact Mass | 622.03 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2-iodo-5-nitrobenzoyl)amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](NC(=O)c2cc([N+](=O)[O-])ccc2I)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H23IN2O12/c1-9(25)32-8-16-17(33-10(2)26)18(34-11(3)27)19(35-12(4)28)21(36-16)23-20(29)14-7-13(24(30)31)5-6-15(14)22/h5-7,16-19,21H,8H2,1-4H3,(H,23,29)/t16-,17+,18+,19-,21-/m1/s1 |
| InChIKey | LWHMLTXWYVYDTA-WVXKDWSHSA-N |
| XLogP | 1.01 |
| TPSA | 186.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|