C19H21ClN2O11 — CID 142216379
[(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-[(2-chloro-4-nitrobenzoyl)amino]-2-(hydroxymethyl)oxan-3-yl] acetate (PubChem CID 142216379) has the molecular formula C19H21ClN2O11 and a molecular weight of 488.83 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-[(2-chloro-4-nitrobenzoyl)amino]-2-(hydroxymethyl)oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-[(2-chloro-4-nitrobenzoyl)amino]-2-(hydroxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 142216379 |
| Molecular Formula | C19H21ClN2O11 |
| Molecular Weight | 488.83 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-[(2-chloro-4-nitrobenzoyl)amino]-2-(hydroxymethyl)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](NC(=O)c2ccc([N+](=O)[O-])cc2Cl)O[C@H](CO)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H21ClN2O11/c1-8(24)30-15-14(7-23)33-19(17(32-10(3)26)16(15)31-9(2)25)21-18(27)12-5-4-11(22(28)29)6-13(12)20/h4-6,14-17,19,23H,7H2,1-3H3,(H,21,27)/t14-,15-,16+,17-,19-/m1/s1 |
| InChIKey | YPZXCWIPJKSJRN-OGJJZOIMSA-N |
| XLogP | 0.49 |
| TPSA | 180.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.83 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|