C14H15ClN2O3 — CID 11892754
N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-2-chloro-4-nitrobenzamide (PubChem CID 11892754) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-2-chloro-4-nitrobenzamide.
| Compound Name | N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-2-chloro-4-nitrobenzamide |
|---|---|
| PubChem CID | 11892754 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-2-chloro-4-nitrobenzamide |
| SMILES | O=C(N[C@H]1C[C@H]2CC[C@@H]1C2)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C14H15ClN2O3/c15-12-7-10(17(19)20)3-4-11(12)14(18)16-13-6-8-1-2-9(13)5-8/h3-4,7-9,13H,1-2,5-6H2,(H,16,18)/t8-,9+,13-/m0/s1 |
| InChIKey | KXDOSJYWKWOEIS-RWEMILLDSA-N |
| XLogP | 3.17 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|