C17H19ClN2O5 — CID 98786605
2-[(2-chloro-4-nitrobenzoyl)amino]ethyl (1S,2R,4S)-bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 98786605) has the molecular formula C17H19ClN2O5 and a molecular weight of 366.80 g/mol. Its IUPAC name is 2-[(2-chloro-4-nitrobenzoyl)amino]ethyl (1S,2R,4S)-bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | 2-[(2-chloro-4-nitrobenzoyl)amino]ethyl (1S,2R,4S)-bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 98786605 |
| Molecular Formula | C17H19ClN2O5 |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 2-[(2-chloro-4-nitrobenzoyl)amino]ethyl (1S,2R,4S)-bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | O=C(NCCOC(=O)[C@@H]1C[C@H]2CC[C@H]1C2)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C17H19ClN2O5/c18-15-9-12(20(23)24)3-4-13(15)16(21)19-5-6-25-17(22)14-8-10-1-2-11(14)7-10/h3-4,9-11,14H,1-2,5-8H2,(H,19,21)/t10-,11-,14+/m0/s1 |
| InChIKey | IWXSIALATLJECA-COPLHBTASA-N |
| XLogP | 2.96 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|