C20H23N3O13 — CID 39355439
[(2R,3S,4S,5R,6R)-3,5,6-triacetyloxy-4-(2,4-dinitroanilino)oxan-2-yl]methyl acetate (PubChem CID 39355439) has the molecular formula C20H23N3O13 and a molecular weight of 513.41 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,5,6-triacetyloxy-4-(2,4-dinitroanilino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,5,6-triacetyloxy-4-(2,4-dinitroanilino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 39355439 |
| Molecular Formula | C20H23N3O13 |
| Molecular Weight | 513.41 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,5,6-triacetyloxy-4-(2,4-dinitroanilino)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H23N3O13/c1-9(24)32-8-16-18(33-10(2)25)17(19(34-11(3)26)20(36-16)35-12(4)27)21-14-6-5-13(22(28)29)7-15(14)23(30)31/h5-7,16-21H,8H2,1-4H3/t16-,17+,18-,19-,20+/m1/s1 |
| InChIKey | QCMWTVCSCZCYCM-IVDHNXQLSA-N |
| XLogP | 1.00 |
| TPSA | 212.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.41 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|