C20H23NO13S — CID 132518473
[(2R,3R,4S,5R,6R)-3,4,6-triacetyloxy-5-(4-nitrophenyl)sulfonyloxan-2-yl]methyl acetate (PubChem CID 132518473) has the molecular formula C20H23NO13S and a molecular weight of 517.47 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,6-triacetyloxy-5-(4-nitrophenyl)sulfonyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,6-triacetyloxy-5-(4-nitrophenyl)sulfonyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 132518473 |
| Molecular Formula | C20H23NO13S |
| Molecular Weight | 517.47 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,6-triacetyloxy-5-(4-nitrophenyl)sulfonyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC(C)=O)[C@H](S(=O)(=O)c2ccc([N+](=O)[O-])cc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H23NO13S/c1-10(22)30-9-16-17(31-11(2)23)18(32-12(3)24)19(20(34-16)33-13(4)25)35(28,29)15-7-5-14(6-8-15)21(26)27/h5-8,16-20H,9H2,1-4H3/t16-,17-,18+,19-,20+/m1/s1 |
| InChIKey | VNEBNFHXUVZZQD-OBKDMQGPSA-N |
| XLogP | 0.45 |
| TPSA | 191.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.47 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|