C30H45NO10 — CID 24809210
[(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[6-(4-tert-butylanilino)hexoxy]oxan-2-yl]methyl acetate (PubChem CID 24809210) has the molecular formula C30H45NO10 and a molecular weight of 579.69 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[6-(4-tert-butylanilino)hexoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[6-(4-tert-butylanilino)hexoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 24809210 |
| Molecular Formula | C30H45NO10 |
| Molecular Weight | 579.69 g/mol |
| Exact Mass | 579.30 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[6-(4-tert-butylanilino)hexoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OCCCCCCNc2ccc(C(C)(C)C)cc2)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H45NO10/c1-19(32)37-18-25-26(38-20(2)33)27(39-21(3)34)28(40-22(4)35)29(41-25)36-17-11-9-8-10-16-31-24-14-12-23(13-15-24)30(5,6)7/h12-15,25-29,31H,8-11,16-18H2,1-7H3/t25-,26-,27+,28+,29+/m1/s1 |
| InChIKey | ZNNMERZWDHCQTL-PNHLWVRCSA-N |
| XLogP | 4.06 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.69 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|