C6H4N3O6SY- — CID 58710597
(2,4-dinitrophenyl)sulfonylazanide;yttrium (PubChem CID 58710597) has the molecular formula C6H4N3O6SY- and a molecular weight of 335.09 g/mol. Its IUPAC name is (2,4-dinitrophenyl)sulfonylazanide;yttrium.
| Compound Name | (2,4-dinitrophenyl)sulfonylazanide;yttrium |
|---|---|
| PubChem CID | 58710597 |
| Molecular Formula | C6H4N3O6SY- |
| Molecular Weight | 335.09 g/mol |
| Exact Mass | 334.89 |
| IUPAC Name | (2,4-dinitrophenyl)sulfonylazanide;yttrium |
| SMILES | [NH-]S(=O)(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-].[Y] |
| InChI | InChI=1S/C6H4N3O6S.Y/c7-16(14,15)6-2-1-4(8(10)11)3-5(6)9(12)13;/h1-3H,(H-,7,14,15);/q-1; |
| InChIKey | ZOQFUTCGBKSNDS-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 144.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.09 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|