C10H9ClN2O6S — CID 5382603
1-[(E)-4-chlorobut-2-enyl]sulfonyl-2,4-dinitrobenzene (PubChem CID 5382603) has the molecular formula C10H9ClN2O6S and a molecular weight of 320.71 g/mol. Its IUPAC name is 1-[(E)-4-chlorobut-2-enyl]sulfonyl-2,4-dinitrobenzene.
| Compound Name | 1-[(E)-4-chlorobut-2-enyl]sulfonyl-2,4-dinitrobenzene |
|---|---|
| PubChem CID | 5382603 |
| Molecular Formula | C10H9ClN2O6S |
| Molecular Weight | 320.71 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 1-[(E)-4-chlorobut-2-enyl]sulfonyl-2,4-dinitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)C/C=C/CCl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H9ClN2O6S/c11-5-1-2-6-20(18,19)10-4-3-8(12(14)15)7-9(10)13(16)17/h1-4,7H,5-6H2/b2-1+ |
| InChIKey | NBQLRNWPLDGTAY-OWOJBTEDSA-N |
| XLogP | 2.07 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.71 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|