C13H16N4O7S — CID 2133711
2-(2,4-dinitrophenyl)sulfonyl-1-(4-methylpiperazin-1-yl)ethanone (PubChem CID 2133711) has the molecular formula C13H16N4O7S and a molecular weight of 372.36 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)sulfonyl-1-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 2-(2,4-dinitrophenyl)sulfonyl-1-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 2133711 |
| Molecular Formula | C13H16N4O7S |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 2-(2,4-dinitrophenyl)sulfonyl-1-(4-methylpiperazin-1-yl)ethanone |
| SMILES | CN1CCN(C(=O)CS(=O)(=O)c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C13H16N4O7S/c1-14-4-6-15(7-5-14)13(18)9-25(23,24)12-3-2-10(16(19)20)8-11(12)17(21)22/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | GDNRZLQMUFFMMO-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 143.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|