C6H3IN2O7S — CID 141193318
iodo 2,4-dinitrobenzenesulfonate (PubChem CID 141193318) has the molecular formula C6H3IN2O7S and a molecular weight of 374.07 g/mol. Its IUPAC name is iodo 2,4-dinitrobenzenesulfonate.
| Compound Name | iodo 2,4-dinitrobenzenesulfonate |
|---|---|
| PubChem CID | 141193318 |
| Molecular Formula | C6H3IN2O7S |
| Molecular Weight | 374.07 g/mol |
| Exact Mass | 373.87 |
| IUPAC Name | iodo 2,4-dinitrobenzenesulfonate |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)OI)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H3IN2O7S/c7-16-17(14,15)6-2-1-4(8(10)11)3-5(6)9(12)13/h1-3H |
| InChIKey | LQJTZNFEAAVSDE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.07 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|