C7H3N5O12S — CID 71443667
2,4-dinitro-1-(trinitromethylsulfonyl)benzene (PubChem CID 71443667) has the molecular formula C7H3N5O12S and a molecular weight of 381.19 g/mol. Its IUPAC name is 2,4-dinitro-1-(trinitromethylsulfonyl)benzene.
| Compound Name | 2,4-dinitro-1-(trinitromethylsulfonyl)benzene |
|---|---|
| PubChem CID | 71443667 |
| Molecular Formula | C7H3N5O12S |
| Molecular Weight | 381.19 g/mol |
| Exact Mass | 380.95 |
| IUPAC Name | 2,4-dinitro-1-(trinitromethylsulfonyl)benzene |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)C([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H3N5O12S/c13-8(14)4-1-2-6(5(3-4)9(15)16)25(23,24)7(10(17)18,11(19)20)12(21)22/h1-3H |
| InChIKey | YDTZOQAHUZTNDA-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 249.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.19 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|