C15H16N2O7SSi — CID 139192155
(2-trimethylsilylphenyl) 2,4-dinitrobenzenesulfonate (PubChem CID 139192155) has the molecular formula C15H16N2O7SSi and a molecular weight of 396.45 g/mol. Its IUPAC name is (2-trimethylsilylphenyl) 2,4-dinitrobenzenesulfonate.
| Compound Name | (2-trimethylsilylphenyl) 2,4-dinitrobenzenesulfonate |
|---|---|
| PubChem CID | 139192155 |
| Molecular Formula | C15H16N2O7SSi |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | (2-trimethylsilylphenyl) 2,4-dinitrobenzenesulfonate |
| SMILES | C[Si](C)(C)c1ccccc1OS(=O)(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H16N2O7SSi/c1-26(2,3)15-7-5-4-6-13(15)24-25(22,23)14-9-8-11(16(18)19)10-12(14)17(20)21/h4-10H,1-3H3 |
| InChIKey | AIYWDANYPOTFTR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|