C20H14N4O9S — CID 14460440
[6,7-bis(aziridin-1-yl)-5,8-dioxonaphthalen-1-yl] 2,4-dinitrobenzenesulfonate (PubChem CID 14460440) has the molecular formula C20H14N4O9S and a molecular weight of 486.42 g/mol. Its IUPAC name is [6,7-bis(aziridin-1-yl)-5,8-dioxonaphthalen-1-yl] 2,4-dinitrobenzenesulfonate.
| Compound Name | [6,7-bis(aziridin-1-yl)-5,8-dioxonaphthalen-1-yl] 2,4-dinitrobenzenesulfonate |
|---|---|
| PubChem CID | 14460440 |
| Molecular Formula | C20H14N4O9S |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | [6,7-bis(aziridin-1-yl)-5,8-dioxonaphthalen-1-yl] 2,4-dinitrobenzenesulfonate |
| SMILES | O=C1C(N2CC2)=C(N2CC2)C(=O)c2c(OS(=O)(=O)c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cccc21 |
| InChI | InChI=1S/C20H14N4O9S/c25-19-12-2-1-3-14(16(12)20(26)18(22-8-9-22)17(19)21-6-7-21)33-34(31,32)15-5-4-11(23(27)28)10-13(15)24(29)30/h1-5,10H,6-9H2 |
| InChIKey | NKYSAJWCELVPLC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 169.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|