C24H18N2O5S — CID 14460441
[6,7-bis(aziridin-1-yl)-5,8-dioxonaphthalen-1-yl] naphthalene-1-sulfonate (PubChem CID 14460441) has the molecular formula C24H18N2O5S and a molecular weight of 446.48 g/mol. Its IUPAC name is [6,7-bis(aziridin-1-yl)-5,8-dioxonaphthalen-1-yl] naphthalene-1-sulfonate.
| Compound Name | [6,7-bis(aziridin-1-yl)-5,8-dioxonaphthalen-1-yl] naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 14460441 |
| Molecular Formula | C24H18N2O5S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | [6,7-bis(aziridin-1-yl)-5,8-dioxonaphthalen-1-yl] naphthalene-1-sulfonate |
| SMILES | O=C1C(N2CC2)=C(N2CC2)C(=O)c2c(OS(=O)(=O)c3cccc4ccccc34)cccc21 |
| InChI | InChI=1S/C24H18N2O5S/c27-23-17-8-4-9-18(20(17)24(28)22(26-13-14-26)21(23)25-11-12-25)31-32(29,30)19-10-3-6-15-5-1-2-7-16(15)19/h1-10H,11-14H2 |
| InChIKey | UZXDOTRUMDBHCU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|