About 2H-triazol-4-yl naphthalene-1-sulfonate
2H-triazol-4-yl naphthalene-1-sulfonate (PubChem CID 174788128) has the molecular formula C12H9N3O3S
and a molecular weight of 275.29 g/mol. Its IUPAC name is 2H-triazol-4-yl naphthalene-1-sulfonate.
Molecular Properties
| Compound Name | 2H-triazol-4-yl naphthalene-1-sulfonate |
| PubChem CID | 174788128 |
| Molecular Formula | C12H9N3O3S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 2H-triazol-4-yl naphthalene-1-sulfonate |
| SMILES | O=S(=O)(Oc1cn[nH]n1)c1cccc2ccccc12 |
| InChI | InChI=1S/C12H9N3O3S/c16-19(17,18-12-8-13-15-14-12)11-7-3-5-9-4-1-2-6-10(9)11/h1-8H,(H,13,14,15) |
| InChIKey | UJYDRUAHENDNTK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2H-triazol-4-yl naphthalene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-triazol-4-yl naphthalene-1-sulfonate?
The IUPAC name of 2H-triazol-4-yl naphthalene-1-sulfonate (CID 174788128) is 2H-triazol-4-yl naphthalene-1-sulfonate.
What is the SMILES notation for 2H-triazol-4-yl naphthalene-1-sulfonate?
The canonical SMILES for 2H-triazol-4-yl naphthalene-1-sulfonate is O=S(=O)(Oc1cn[nH]n1)c1cccc2ccccc12.
What is the InChIKey of 2H-triazol-4-yl naphthalene-1-sulfonate?
The InChIKey is UJYDRUAHENDNTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O3S/c16-19(17,18-12-8-13-15-14-12)11-7-3-5-9-4-1-2-6-10(9)11/h1-8H,(H,13,14,15).
What are the key properties of 2H-triazol-4-yl naphthalene-1-sulfonate?
2H-triazol-4-yl naphthalene-1-sulfonate has a molecular weight of 275.29 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-triazol-4-yl naphthalene-1-sulfonate is sourced from PubChem (CID 174788128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).