About (2-trimethylsilylphenyl) 4-nitrobenzenesulfonate
(2-trimethylsilylphenyl) 4-nitrobenzenesulfonate (PubChem CID 122380054) has the molecular formula C15H17NO5SSi
and a molecular weight of 351.46 g/mol. Its IUPAC name is (2-trimethylsilylphenyl) 4-nitrobenzenesulfonate.
Molecular Properties
| Compound Name | (2-trimethylsilylphenyl) 4-nitrobenzenesulfonate |
| PubChem CID | 122380054 |
| Molecular Formula | C15H17NO5SSi |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | (2-trimethylsilylphenyl) 4-nitrobenzenesulfonate |
| SMILES | C[Si](C)(C)c1ccccc1OS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H17NO5SSi/c1-23(2,3)15-7-5-4-6-14(15)21-22(19,20)13-10-8-12(9-11-13)16(17)18/h4-11H,1-3H3 |
| InChIKey | FUHQITNDYBOEMN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-trimethylsilylphenyl) 4-nitrobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-trimethylsilylphenyl) 4-nitrobenzenesulfonate?
The IUPAC name of (2-trimethylsilylphenyl) 4-nitrobenzenesulfonate (CID 122380054) is (2-trimethylsilylphenyl) 4-nitrobenzenesulfonate.
What is the SMILES notation for (2-trimethylsilylphenyl) 4-nitrobenzenesulfonate?
The canonical SMILES for (2-trimethylsilylphenyl) 4-nitrobenzenesulfonate is C[Si](C)(C)c1ccccc1OS(=O)(=O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (2-trimethylsilylphenyl) 4-nitrobenzenesulfonate?
The InChIKey is FUHQITNDYBOEMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO5SSi/c1-23(2,3)15-7-5-4-6-14(15)21-22(19,20)13-10-8-12(9-11-13)16(17)18/h4-11H,1-3H3.
What are the key properties of (2-trimethylsilylphenyl) 4-nitrobenzenesulfonate?
(2-trimethylsilylphenyl) 4-nitrobenzenesulfonate has a molecular weight of 351.46 g/mol, XLogP of 2.91, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-trimethylsilylphenyl) 4-nitrobenzenesulfonate is sourced from PubChem (CID 122380054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).