C29H27NO8S2 — CID 87666959
[4-methyl-2-[3-[2-(4-nitrophenyl)sulfonyloxyphenyl]propyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 87666959) has the molecular formula C29H27NO8S2 and a molecular weight of 581.67 g/mol. Its IUPAC name is [4-methyl-2-[3-[2-(4-nitrophenyl)sulfonyloxyphenyl]propyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-methyl-2-[3-[2-(4-nitrophenyl)sulfonyloxyphenyl]propyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87666959 |
| Molecular Formula | C29H27NO8S2 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.12 |
| IUPAC Name | [4-methyl-2-[3-[2-(4-nitrophenyl)sulfonyloxyphenyl]propyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(C)cc2CCCc2ccccc2OS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C29H27NO8S2/c1-21-10-15-26(16-11-21)39(33,34)38-29-19-12-22(2)20-24(29)8-5-7-23-6-3-4-9-28(23)37-40(35,36)27-17-13-25(14-18-27)30(31)32/h3-4,6,9-20H,5,7-8H2,1-2H3 |
| InChIKey | FKMIKQBBZXBROM-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 129.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|