About (2-propylphenyl) benzenesulfonate
(2-propylphenyl) benzenesulfonate (PubChem CID 19966677) has the molecular formula C15H16O3S
and a molecular weight of 276.36 g/mol. Its IUPAC name is (2-propylphenyl) benzenesulfonate.
Molecular Properties
| Compound Name | (2-propylphenyl) benzenesulfonate |
| PubChem CID | 19966677 |
| Molecular Formula | C15H16O3S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | (2-propylphenyl) benzenesulfonate |
| SMILES | CCCc1ccccc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H16O3S/c1-2-8-13-9-6-7-12-15(13)18-19(16,17)14-10-4-3-5-11-14/h3-7,9-12H,2,8H2,1H3 |
| InChIKey | UIIGTZDGXFYFAQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-propylphenyl) benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-propylphenyl) benzenesulfonate?
The IUPAC name of (2-propylphenyl) benzenesulfonate (CID 19966677) is (2-propylphenyl) benzenesulfonate.
What is the SMILES notation for (2-propylphenyl) benzenesulfonate?
The canonical SMILES for (2-propylphenyl) benzenesulfonate is CCCc1ccccc1OS(=O)(=O)c1ccccc1.
What is the InChIKey of (2-propylphenyl) benzenesulfonate?
The InChIKey is UIIGTZDGXFYFAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O3S/c1-2-8-13-9-6-7-12-15(13)18-19(16,17)14-10-4-3-5-11-14/h3-7,9-12H,2,8H2,1H3.
What are the key properties of (2-propylphenyl) benzenesulfonate?
(2-propylphenyl) benzenesulfonate has a molecular weight of 276.36 g/mol, XLogP of 3.41, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-propylphenyl) benzenesulfonate is sourced from PubChem (CID 19966677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).