About (2-pentylphenyl) benzenesulfonate
(2-pentylphenyl) benzenesulfonate (PubChem CID 88574492) has the molecular formula C17H20O3S
and a molecular weight of 304.41 g/mol. Its IUPAC name is (2-pentylphenyl) benzenesulfonate.
Molecular Properties
| Compound Name | (2-pentylphenyl) benzenesulfonate |
| PubChem CID | 88574492 |
| Molecular Formula | C17H20O3S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (2-pentylphenyl) benzenesulfonate |
| SMILES | CCCCCc1ccccc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H20O3S/c1-2-3-5-10-15-11-8-9-14-17(15)20-21(18,19)16-12-6-4-7-13-16/h4,6-9,11-14H,2-3,5,10H2,1H3 |
| InChIKey | POGVCBJFEXCHOA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-pentylphenyl) benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-pentylphenyl) benzenesulfonate?
The IUPAC name of (2-pentylphenyl) benzenesulfonate (CID 88574492) is (2-pentylphenyl) benzenesulfonate.
What is the SMILES notation for (2-pentylphenyl) benzenesulfonate?
The canonical SMILES for (2-pentylphenyl) benzenesulfonate is CCCCCc1ccccc1OS(=O)(=O)c1ccccc1.
What is the InChIKey of (2-pentylphenyl) benzenesulfonate?
The InChIKey is POGVCBJFEXCHOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O3S/c1-2-3-5-10-15-11-8-9-14-17(15)20-21(18,19)16-12-6-4-7-13-16/h4,6-9,11-14H,2-3,5,10H2,1H3.
What are the key properties of (2-pentylphenyl) benzenesulfonate?
(2-pentylphenyl) benzenesulfonate has a molecular weight of 304.41 g/mol, XLogP of 4.19, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-pentylphenyl) benzenesulfonate is sourced from PubChem (CID 88574492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).