copper;(2-nonylphenyl) hydrogen sulfate

C15H24CuO4S — CID 70922107

IUPACcopper;(2-nonylphenyl) hydrogen sulfate
SMILESCCCCCCCCCc1ccccc1OS(=O)(=O)O.[Cu]
InChIInChI=1S/C15H24O4S.Cu/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)19-20(16,17)18;/h9-10,12-13H,2-8,11H2,1H3,(H,16,17,18);
InChIKeyNWNIGESWEPKGTJ-UHFFFAOYSA-N
MW363.97 g/mol
LogP4.16
Rot. Bonds10

About copper;(2-nonylphenyl) hydrogen sulfate

copper;(2-nonylphenyl) hydrogen sulfate (PubChem CID 70922107) has the molecular formula C15H24CuO4S and a molecular weight of 363.97 g/mol. Its IUPAC name is copper;(2-nonylphenyl) hydrogen sulfate.

Molecular Properties

Compound Namecopper;(2-nonylphenyl) hydrogen sulfate
PubChem CID70922107
Molecular FormulaC15H24CuO4S
Molecular Weight363.97 g/mol
Exact Mass363.07
IUPAC Namecopper;(2-nonylphenyl) hydrogen sulfate
SMILESCCCCCCCCCc1ccccc1OS(=O)(=O)O.[Cu]
InChIInChI=1S/C15H24O4S.Cu/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)19-20(16,17)18;/h9-10,12-13H,2-8,11H2,1H3,(H,16,17,18);
InChIKeyNWNIGESWEPKGTJ-UHFFFAOYSA-N
XLogP4.16
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds10
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500363.97
LogP ≤ 54.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze copper;(2-nonylphenyl) hydrogen sulfate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2-propylphenyl) hydrogen sulfate
CID 22461372
azane;1-nonyl-2-(2-nonylphenoxy)benzene;sulfuric acid
CID 172996794
(2-octadecylphenyl) iodomethanesulfonate
CID 174582605
(3-butyl-2-phenylphenyl) hydrogen sulfate
CID 66641312
(2-nonylphenoxy)sulfamic acid
CID 138544155
(2-pentylphenyl) benzenesulfonate
CID 88574492
sodium;1-nonyl-2-(2-nonylphenoxy)benzene;sulfate
CID 5463920
2-(2-dodecylphenoxy)benzene-1,3-disulfonic acid
CID 101303574
(2,3-dioctylphenyl) sulfo sulfate
CID 123552516
2-(2-dodecylphenoxy)-6-hydroxybenzenesulfonic acid
CID 101296002
[1,1-diethoxy-2-(2-octylphenoxy)ethyl] hydrogen sulfate
CID 23028152
sodium;hydride;2-[2-(2-nonylphenoxy)ethoxy]ethyl hydrogen sulfate
CID 173325044

Frequently Asked Questions

What is the IUPAC name of copper;(2-nonylphenyl) hydrogen sulfate?
The IUPAC name of copper;(2-nonylphenyl) hydrogen sulfate (CID 70922107) is copper;(2-nonylphenyl) hydrogen sulfate.
What is the SMILES notation for copper;(2-nonylphenyl) hydrogen sulfate?
The canonical SMILES for copper;(2-nonylphenyl) hydrogen sulfate is CCCCCCCCCc1ccccc1OS(=O)(=O)O.[Cu].
What is the InChIKey of copper;(2-nonylphenyl) hydrogen sulfate?
The InChIKey is NWNIGESWEPKGTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O4S.Cu/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)19-20(16,17)18;/h9-10,12-13H,2-8,11H2,1H3,(H,16,17,18);.
What are the key properties of copper;(2-nonylphenyl) hydrogen sulfate?
copper;(2-nonylphenyl) hydrogen sulfate has a molecular weight of 363.97 g/mol, XLogP of 4.16, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for copper;(2-nonylphenyl) hydrogen sulfate is sourced from PubChem (CID 70922107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).