C19H33NaO6S — CID 173325044
sodium;hydride;2-[2-(2-nonylphenoxy)ethoxy]ethyl hydrogen sulfate (PubChem CID 173325044) has the molecular formula C19H33NaO6S and a molecular weight of 412.52 g/mol. Its IUPAC name is sodium;hydride;2-[2-(2-nonylphenoxy)ethoxy]ethyl hydrogen sulfate.
| Compound Name | sodium;hydride;2-[2-(2-nonylphenoxy)ethoxy]ethyl hydrogen sulfate |
|---|---|
| PubChem CID | 173325044 |
| Molecular Formula | C19H33NaO6S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | sodium;hydride;2-[2-(2-nonylphenoxy)ethoxy]ethyl hydrogen sulfate |
| SMILES | CCCCCCCCCc1ccccc1OCCOCCOS(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C19H32O6S.Na.H/c1-2-3-4-5-6-7-8-11-18-12-9-10-13-19(18)24-16-14-23-15-17-25-26(20,21)22;;/h9-10,12-13H,2-8,11,14-17H2,1H3,(H,20,21,22);;/q;+1;-1 |
| InChIKey | FIHLAKHWHDXNQB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|