C20H36O8S — CID 172695363
2-[2-[2-(2-octylphenoxy)ethoxy]ethoxy]ethanol;sulfuric acid (PubChem CID 172695363) has the molecular formula C20H36O8S and a molecular weight of 436.57 g/mol. Its IUPAC name is 2-[2-[2-(2-octylphenoxy)ethoxy]ethoxy]ethanol;sulfuric acid.
| Compound Name | 2-[2-[2-(2-octylphenoxy)ethoxy]ethoxy]ethanol;sulfuric acid |
|---|---|
| PubChem CID | 172695363 |
| Molecular Formula | C20H36O8S |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 2-[2-[2-(2-octylphenoxy)ethoxy]ethoxy]ethanol;sulfuric acid |
| SMILES | CCCCCCCCc1ccccc1OCCOCCOCCO.O=S(=O)(O)O |
| InChI | InChI=1S/C20H34O4.H2O4S/c1-2-3-4-5-6-7-10-19-11-8-9-12-20(19)24-18-17-23-16-15-22-14-13-21;1-5(2,3)4/h8-9,11-12,21H,2-7,10,13-18H2,1H3;(H2,1,2,3,4) |
| InChIKey | CGCDZGADAMQYQZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|