C19H31NaO6S — CID 161424912
sodium 2-[2-(2-nonylphenoxy)ethoxy]ethyl sulfate (PubChem CID 161424912) has the molecular formula C19H31NaO6S and a molecular weight of 410.51 g/mol. Its IUPAC name is sodium 2-[2-(2-nonylphenoxy)ethoxy]ethyl sulfate.
| Compound Name | sodium 2-[2-(2-nonylphenoxy)ethoxy]ethyl sulfate |
|---|---|
| PubChem CID | 161424912 |
| Molecular Formula | C19H31NaO6S |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | sodium 2-[2-(2-nonylphenoxy)ethoxy]ethyl sulfate |
| SMILES | CCCCCCCCCc1ccccc1OCCOCCOS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C19H32O6S.Na/c1-2-3-4-5-6-7-8-11-18-12-9-10-13-19(18)24-16-14-23-15-17-25-26(20,21)22;/h9-10,12-13H,2-8,11,14-17H2,1H3,(H,20,21,22);/q;+1/p-1 |
| InChIKey | VXFQJDCYPAQCNG-UHFFFAOYSA-M |
| XLogP | 0.86 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|