About sodium;dodecyl sulfate;2-octylphenol
sodium;dodecyl sulfate;2-octylphenol (PubChem CID 158385369) has the molecular formula C26H47NaO5S
and a molecular weight of 494.71 g/mol. Its IUPAC name is sodium;dodecyl sulfate;2-octylphenol.
Molecular Properties
| Compound Name | sodium;dodecyl sulfate;2-octylphenol |
| PubChem CID | 158385369 |
| Molecular Formula | C26H47NaO5S |
| Molecular Weight | 494.71 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | sodium;dodecyl sulfate;2-octylphenol |
| SMILES | CCCCCCCCCCCCOS(=O)(=O)[O-].CCCCCCCCc1ccccc1O.[Na+] |
| InChI | InChI=1S/C14H22O.C12H26O4S.Na/c1-2-3-4-5-6-7-10-13-11-8-9-12-14(13)15;1-2-3-4-5-6-7-8-9-10-11-12-16-17(13,14)15;/h8-9,11-12,15H,2-7,10H2,1H3;2-12H2,1H3,(H,13,14,15);/q;;+1/p-1 |
| InChIKey | GWHMIBALEDGJMT-UHFFFAOYSA-M |
| XLogP | 4.68 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 494.71 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze sodium;dodecyl sulfate;2-octylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;dodecyl sulfate;2-octylphenol?
The IUPAC name of sodium;dodecyl sulfate;2-octylphenol (CID 158385369) is sodium;dodecyl sulfate;2-octylphenol.
What is the SMILES notation for sodium;dodecyl sulfate;2-octylphenol?
The canonical SMILES for sodium;dodecyl sulfate;2-octylphenol is CCCCCCCCCCCCOS(=O)(=O)[O-].CCCCCCCCc1ccccc1O.[Na+].
What is the InChIKey of sodium;dodecyl sulfate;2-octylphenol?
The InChIKey is GWHMIBALEDGJMT-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H22O.C12H26O4S.Na/c1-2-3-4-5-6-7-10-13-11-8-9-12-14(13)15;1-2-3-4-5-6-7-8-9-10-11-12-16-17(13,14)15;/h8-9,11-12,15H,2-7,10H2,1H3;2-12H2,1H3,(H,13,14,15);/q;;+1/p-1.
What are the key properties of sodium;dodecyl sulfate;2-octylphenol?
sodium;dodecyl sulfate;2-octylphenol has a molecular weight of 494.71 g/mol, XLogP of 4.68, 19 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;dodecyl sulfate;2-octylphenol is sourced from PubChem (CID 158385369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).