C30H46NaO5S- — CID 5463920
sodium;1-nonyl-2-(2-nonylphenoxy)benzene;sulfate (PubChem CID 5463920) has the molecular formula C30H46NaO5S- and a molecular weight of 541.75 g/mol. Its IUPAC name is sodium;1-nonyl-2-(2-nonylphenoxy)benzene;sulfate.
| Compound Name | sodium;1-nonyl-2-(2-nonylphenoxy)benzene;sulfate |
|---|---|
| PubChem CID | 5463920 |
| Molecular Formula | C30H46NaO5S- |
| Molecular Weight | 541.75 g/mol |
| Exact Mass | 541.30 |
| IUPAC Name | sodium;1-nonyl-2-(2-nonylphenoxy)benzene;sulfate |
| SMILES | CCCCCCCCCc1ccccc1Oc1ccccc1CCCCCCCCC.O=S(=O)([O-])[O-].[Na+] |
| InChI | InChI=1S/C30H46O.Na.H2O4S/c1-3-5-7-9-11-13-15-21-27-23-17-19-25-29(27)31-30-26-20-18-24-28(30)22-16-14-12-10-8-6-4-2;;1-5(2,3)4/h17-20,23-26H,3-16,21-22H2,1-2H3;;(H2,1,2,3,4)/q;+1;/p-2 |
| InChIKey | ZZMDMGNQUXYKQX-UHFFFAOYSA-L |
| XLogP | 5.73 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.75 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|