C20H25NaO5S — CID 101293840
sodium 3-(2-octylphenoxy)-4-sulfophenolate (PubChem CID 101293840) has the molecular formula C20H25NaO5S and a molecular weight of 400.47 g/mol. Its IUPAC name is sodium 3-(2-octylphenoxy)-4-sulfophenolate.
| Compound Name | sodium 3-(2-octylphenoxy)-4-sulfophenolate |
|---|---|
| PubChem CID | 101293840 |
| Molecular Formula | C20H25NaO5S |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | sodium 3-(2-octylphenoxy)-4-sulfophenolate |
| SMILES | CCCCCCCCc1ccccc1Oc1cc([O-])ccc1S(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C20H26O5S.Na/c1-2-3-4-5-6-7-10-16-11-8-9-12-18(16)25-19-15-17(21)13-14-20(19)26(22,23)24;/h8-9,11-15,21H,2-7,10H2,1H3,(H,22,23,24);/q;+1/p-1 |
| InChIKey | BWGFIEKMYXYGHZ-UHFFFAOYSA-M |
| XLogP | 1.71 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|